C15H21Cl4N3O — CID 119925971
2-[2-(aminomethyl)-3-methylpiperidin-1-yl]-N-(2,4,5-trichlorophenyl)acetamide;hydrochloride (PubChem CID 119925971) has the molecular formula C15H21Cl4N3O and a molecular weight of 401.17 g/mol. Its IUPAC name is 2-[2-(aminomethyl)-3-methylpiperidin-1-yl]-N-(2,4,5-trichlorophenyl)acetamide;hydrochloride.
| Compound Name | 2-[2-(aminomethyl)-3-methylpiperidin-1-yl]-N-(2,4,5-trichlorophenyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119925971 |
| Molecular Formula | C15H21Cl4N3O |
| Molecular Weight | 401.17 g/mol |
| Exact Mass | 399.04 |
| IUPAC Name | 2-[2-(aminomethyl)-3-methylpiperidin-1-yl]-N-(2,4,5-trichlorophenyl)acetamide;hydrochloride |
| SMILES | CC1CCCN(CC(=O)Nc2cc(Cl)c(Cl)cc2Cl)C1CN.Cl |
| InChI | InChI=1S/C15H20Cl3N3O.ClH/c1-9-3-2-4-21(14(9)7-19)8-15(22)20-13-6-11(17)10(16)5-12(13)18;/h5-6,9,14H,2-4,7-8,19H2,1H3,(H,20,22);1H |
| InChIKey | XLLVCXBXOAIIDP-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.17 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|