C18H25N3O3 — CID 119933392
N-(1,3-benzodioxol-5-yl)-2-(1,4-diazaspiro[5.5]undecan-1-yl)acetamide (PubChem CID 119933392) has the molecular formula C18H25N3O3 and a molecular weight of 331.42 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-(1,4-diazaspiro[5.5]undecan-1-yl)acetamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-(1,4-diazaspiro[5.5]undecan-1-yl)acetamide |
|---|---|
| PubChem CID | 119933392 |
| Molecular Formula | C18H25N3O3 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-(1,4-diazaspiro[5.5]undecan-1-yl)acetamide |
| SMILES | O=C(CN1CCNCC12CCCCC2)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H25N3O3/c22-17(20-14-4-5-15-16(10-14)24-13-23-15)11-21-9-8-19-12-18(21)6-2-1-3-7-18/h4-5,10,19H,1-3,6-9,11-13H2,(H,20,22) |
| InChIKey | MVISATNWWIEEJR-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |