C20H25NO2 — CID 11997057
9-cyclopropyl-3,3,6,6-tetramethyl-2,4,5,7-tetrahydroacridine-1,8-dione (PubChem CID 11997057) has the molecular formula C20H25NO2 and a molecular weight of 311.43 g/mol. Its IUPAC name is 9-cyclopropyl-3,3,6,6-tetramethyl-2,4,5,7-tetrahydroacridine-1,8-dione.
| Compound Name | 9-cyclopropyl-3,3,6,6-tetramethyl-2,4,5,7-tetrahydroacridine-1,8-dione |
|---|---|
| PubChem CID | 11997057 |
| Molecular Formula | C20H25NO2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | 9-cyclopropyl-3,3,6,6-tetramethyl-2,4,5,7-tetrahydroacridine-1,8-dione |
| SMILES | CC1(C)CC(=O)c2c(nc3c(c2C2CC2)C(=O)CC(C)(C)C3)C1 |
| InChI | InChI=1S/C20H25NO2/c1-19(2)7-12-17(14(22)9-19)16(11-5-6-11)18-13(21-12)8-20(3,4)10-15(18)23/h11H,5-10H2,1-4H3 |
| InChIKey | MBSFEBFVLNTNQQ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |