C41H59NO6Si — CID 12003658
tert-butyl (4R)-4-[(2R,4R,6R)-4-[tert-butyl(diphenyl)silyl]oxy-6-[[(2R,6S)-4-methylidene-6-prop-2-enyloxan-2-yl]methyl]oxan-2-yl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 12003658) has the molecular formula C41H59NO6Si and a molecular weight of 690.01 g/mol. Its IUPAC name is tert-butyl (4R)-4-[(2R,4R,6R)-4-[tert-butyl(diphenyl)silyl]oxy-6-[[(2R,6S)-4-methylidene-6-prop-2-enyloxan-2-yl]methyl]oxan-2-yl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4R)-4-[(2R,4R,6R)-4-[tert-butyl(diphenyl)silyl]oxy-6-[[(2R,6S)-4-methylidene-6-prop-2-enyloxan-2-yl]methyl]oxan-2-yl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 12003658 |
| Molecular Formula | C41H59NO6Si |
| Molecular Weight | 690.01 g/mol |
| Exact Mass | 689.41 |
| IUPAC Name | tert-butyl (4R)-4-[(2R,4R,6R)-4-[tert-butyl(diphenyl)silyl]oxy-6-[[(2R,6S)-4-methylidene-6-prop-2-enyloxan-2-yl]methyl]oxan-2-yl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | C=CC[C@H]1CC(=C)C[C@H](C[C@@H]2C[C@@H](O[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)C[C@H]([C@H]3COC(C)(C)N3C(=O)OC(C)(C)C)O2)O1 |
| InChI | InChI=1S/C41H59NO6Si/c1-11-18-30-23-29(2)24-31(45-30)25-32-26-33(27-37(46-32)36-28-44-41(9,10)42(36)38(43)47-39(3,4)5)48-49(40(6,7)8,34-19-14-12-15-20-34)35-21-16-13-17-22-35/h11-17,19-22,30-33,36-37H,1-2,18,23-28H2,3-10H3/t30-,31+,32+,33+,36+,37+/m0/s1 |
| InChIKey | ZMJCYFLPHBHWMI-UVJUMCFDSA-N |
| XLogP | 7.92 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.01 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|