C20H20FNO4 — CID 12004358
3-(1,3-benzodioxol-5-yl)-7-fluoro-3-hydroxy-1-pentylindol-2-one (PubChem CID 12004358) has the molecular formula C20H20FNO4 and a molecular weight of 357.38 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-7-fluoro-3-hydroxy-1-pentylindol-2-one.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-7-fluoro-3-hydroxy-1-pentylindol-2-one |
|---|---|
| PubChem CID | 12004358 |
| Molecular Formula | C20H20FNO4 |
| Molecular Weight | 357.38 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-7-fluoro-3-hydroxy-1-pentylindol-2-one |
| SMILES | CCCCCN1C(=O)C(O)(c2ccc3c(c2)OCO3)c2cccc(F)c21 |
| InChI | InChI=1S/C20H20FNO4/c1-2-3-4-10-22-18-14(6-5-7-15(18)21)20(24,19(22)23)13-8-9-16-17(11-13)26-12-25-16/h5-9,11,24H,2-4,10,12H2,1H3 |
| InChIKey | PIENEKJVBVMGKP-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.38 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|