C18H13F6N3S — CID 12008570
3-benzylsulfanyl-4-(trifluoromethyl)-1-[4-(trifluoromethyl)phenyl]pyrazol-5-amine (PubChem CID 12008570) has the molecular formula C18H13F6N3S and a molecular weight of 417.38 g/mol. Its IUPAC name is 3-benzylsulfanyl-4-(trifluoromethyl)-1-[4-(trifluoromethyl)phenyl]pyrazol-5-amine.
| Compound Name | 3-benzylsulfanyl-4-(trifluoromethyl)-1-[4-(trifluoromethyl)phenyl]pyrazol-5-amine |
|---|---|
| PubChem CID | 12008570 |
| Molecular Formula | C18H13F6N3S |
| Molecular Weight | 417.38 g/mol |
| Exact Mass | 417.07 |
| IUPAC Name | 3-benzylsulfanyl-4-(trifluoromethyl)-1-[4-(trifluoromethyl)phenyl]pyrazol-5-amine |
| SMILES | Nc1c(C(F)(F)F)c(SCc2ccccc2)nn1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H13F6N3S/c19-17(20,21)12-6-8-13(9-7-12)27-15(25)14(18(22,23)24)16(26-27)28-10-11-4-2-1-3-5-11/h1-9H,10,25H2 |
| InChIKey | DGUGHXWKBXVTCC-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.38 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |