C14H10F4N2O2S — CID 175114386
[6-benzylsulfanyl-5-fluoro-4-(trifluoromethyl)-3-pyridinyl] carbamate (PubChem CID 175114386) has the molecular formula C14H10F4N2O2S and a molecular weight of 346.31 g/mol. Its IUPAC name is [6-benzylsulfanyl-5-fluoro-4-(trifluoromethyl)-3-pyridinyl] carbamate.
| Compound Name | [6-benzylsulfanyl-5-fluoro-4-(trifluoromethyl)-3-pyridinyl] carbamate |
|---|---|
| PubChem CID | 175114386 |
| Molecular Formula | C14H10F4N2O2S |
| Molecular Weight | 346.31 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | [6-benzylsulfanyl-5-fluoro-4-(trifluoromethyl)-3-pyridinyl] carbamate |
| SMILES | NC(=O)Oc1cnc(SCc2ccccc2)c(F)c1C(F)(F)F |
| InChI | InChI=1S/C14H10F4N2O2S/c15-11-10(14(16,17)18)9(22-13(19)21)6-20-12(11)23-7-8-4-2-1-3-5-8/h1-6H,7H2,(H2,19,21) |
| InChIKey | PUXZWFVTIDEXFW-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.31 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |