C21H22F3N3OS2 — CID 18934840
2,5-bis(benzylsulfanyl)-4,4-dimethylimidazole;2,2,2-trifluoroacetamide (PubChem CID 18934840) has the molecular formula C21H22F3N3OS2 and a molecular weight of 453.56 g/mol. Its IUPAC name is 2,5-bis(benzylsulfanyl)-4,4-dimethylimidazole;2,2,2-trifluoroacetamide.
| Compound Name | 2,5-bis(benzylsulfanyl)-4,4-dimethylimidazole;2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 18934840 |
| Molecular Formula | C21H22F3N3OS2 |
| Molecular Weight | 453.56 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | 2,5-bis(benzylsulfanyl)-4,4-dimethylimidazole;2,2,2-trifluoroacetamide |
| SMILES | CC1(C)N=C(SCc2ccccc2)N=C1SCc1ccccc1.NC(=O)C(F)(F)F |
| InChI | InChI=1S/C19H20N2S2.C2H2F3NO/c1-19(2)17(22-13-15-9-5-3-6-10-15)20-18(21-19)23-14-16-11-7-4-8-12-16;3-2(4,5)1(6)7/h3-12H,13-14H2,1-2H3;(H2,6,7) |
| InChIKey | RKPQMPDECWJXNH-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 67.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.56 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |