C23H28N2S2 — CID 18934857
2,5-bis[(2-ethylphenyl)methylsulfanyl]-4,4-dimethylimidazole (PubChem CID 18934857) has the molecular formula C23H28N2S2 and a molecular weight of 396.63 g/mol. Its IUPAC name is 2,5-bis[(2-ethylphenyl)methylsulfanyl]-4,4-dimethylimidazole.
| Compound Name | 2,5-bis[(2-ethylphenyl)methylsulfanyl]-4,4-dimethylimidazole |
|---|---|
| PubChem CID | 18934857 |
| Molecular Formula | C23H28N2S2 |
| Molecular Weight | 396.63 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 2,5-bis[(2-ethylphenyl)methylsulfanyl]-4,4-dimethylimidazole |
| SMILES | CCc1ccccc1CSC1=NC(C)(C)C(SCc2ccccc2CC)=N1 |
| InChI | InChI=1S/C23H28N2S2/c1-5-17-11-7-9-13-19(17)15-26-21-23(3,4)25-22(24-21)27-16-20-14-10-8-12-18(20)6-2/h7-14H,5-6,15-16H2,1-4H3 |
| InChIKey | CTGRFVGDXIIPFX-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.63 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |