C20H39NO4Si — CID 12010536
tert-butyl (2S,3S)-3-butyl-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-oxopyrrolidine-1-carboxylate (PubChem CID 12010536) has the molecular formula C20H39NO4Si and a molecular weight of 385.62 g/mol. Its IUPAC name is tert-butyl (2S,3S)-3-butyl-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-oxopyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,3S)-3-butyl-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-oxopyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 12010536 |
| Molecular Formula | C20H39NO4Si |
| Molecular Weight | 385.62 g/mol |
| Exact Mass | 385.26 |
| IUPAC Name | tert-butyl (2S,3S)-3-butyl-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-oxopyrrolidine-1-carboxylate |
| SMILES | CCCC[C@H]1CC(=O)N(C(=O)OC(C)(C)C)[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H39NO4Si/c1-10-11-12-15-13-17(22)21(18(23)25-19(2,3)4)16(15)14-24-26(8,9)20(5,6)7/h15-16H,10-14H2,1-9H3/t15-,16+/m0/s1 |
| InChIKey | PAOLOUBYBRHFFD-JKSUJKDBSA-N |
| XLogP | 5.35 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.62 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|