About N'-[(E)-1-phenylethylideneamino]-N-(triphenyl-λ5-phosphanylidene)ethanimidamide
N'-[(E)-1-phenylethylideneamino]-N-(triphenyl-λ5-phosphanylidene)ethanimidamide (PubChem CID 12012455) has the molecular formula C28H26N3P
and a molecular weight of 435.51 g/mol. Its IUPAC name is N'-[(E)-1-phenylethylideneamino]-N-(triphenyl-λ5-phosphanylidene)ethanimidamide.
Molecular Properties
| Compound Name | N'-[(E)-1-phenylethylideneamino]-N-(triphenyl-λ5-phosphanylidene)ethanimidamide |
| PubChem CID | 12012455 |
| Molecular Formula | C28H26N3P |
| Molecular Weight | 435.51 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | N'-[(E)-1-phenylethylideneamino]-N-(triphenyl-λ5-phosphanylidene)ethanimidamide |
| SMILES | C/C(N=P(c1ccccc1)(c1ccccc1)c1ccccc1)=N\N=C(/C)c1ccccc1 |
| InChI | InChI=1S/C28H26N3P/c1-23(25-15-7-3-8-16-25)29-30-24(2)31-32(26-17-9-4-10-18-26,27-19-11-5-12-20-27)28-21-13-6-14-22-28/h3-22H,1-2H3/b29-23+,30-24+ |
| InChIKey | VDGHGDPSFPVGPI-HCTXVGCHSA-N |
| XLogP | 6.01 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 435.51 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze N'-[(E)-1-phenylethylideneamino]-N-(triphenyl-λ5-phosphanylidene)ethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(E)-1-phenylethylideneamino]-N-(triphenyl-λ5-phosphanylidene)ethanimidamide?
The IUPAC name of N'-[(E)-1-phenylethylideneamino]-N-(triphenyl-λ5-phosphanylidene)ethanimidamide (CID 12012455) is N'-[(E)-1-phenylethylideneamino]-N-(triphenyl-λ5-phosphanylidene)ethanimidamide.
What is the SMILES notation for N'-[(E)-1-phenylethylideneamino]-N-(triphenyl-λ5-phosphanylidene)ethanimidamide?
The canonical SMILES for N'-[(E)-1-phenylethylideneamino]-N-(triphenyl-λ5-phosphanylidene)ethanimidamide is C/C(N=P(c1ccccc1)(c1ccccc1)c1ccccc1)=N\N=C(/C)c1ccccc1.
What is the InChIKey of N'-[(E)-1-phenylethylideneamino]-N-(triphenyl-λ5-phosphanylidene)ethanimidamide?
The InChIKey is VDGHGDPSFPVGPI-HCTXVGCHSA-N. The full InChI is InChI=1S/C28H26N3P/c1-23(25-15-7-3-8-16-25)29-30-24(2)31-32(26-17-9-4-10-18-26,27-19-11-5-12-20-27)28-21-13-6-14-22-28/h3-22H,1-2H3/b29-23+,30-24+.
What are the key properties of N'-[(E)-1-phenylethylideneamino]-N-(triphenyl-λ5-phosphanylidene)ethanimidamide?
N'-[(E)-1-phenylethylideneamino]-N-(triphenyl-λ5-phosphanylidene)ethanimidamide has a molecular weight of 435.51 g/mol, XLogP of 6.01, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(E)-1-phenylethylideneamino]-N-(triphenyl-λ5-phosphanylidene)ethanimidamide is sourced from PubChem (CID 12012455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).