C21H17NO5 — CID 12014003
17,18-dimethoxy-13-methyl-3,5-dioxa-13-azapentacyclo[10.8.1.02,6.08,21.015,20]henicosa-1(21),2(6),7,9,11,15,17,19-octaen-14-one (PubChem CID 12014003) has the molecular formula C21H17NO5 and a molecular weight of 363.37 g/mol. Its IUPAC name is 17,18-dimethoxy-13-methyl-3,5-dioxa-13-azapentacyclo[10.8.1.02,6.08,21.015,20]henicosa-1(21),2(6),7,9,11,15,17,19-octaen-14-one.
| Compound Name | 17,18-dimethoxy-13-methyl-3,5-dioxa-13-azapentacyclo[10.8.1.02,6.08,21.015,20]henicosa-1(21),2(6),7,9,11,15,17,19-octaen-14-one |
|---|---|
| PubChem CID | 12014003 |
| Molecular Formula | C21H17NO5 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | 17,18-dimethoxy-13-methyl-3,5-dioxa-13-azapentacyclo[10.8.1.02,6.08,21.015,20]henicosa-1(21),2(6),7,9,11,15,17,19-octaen-14-one |
| SMILES | COc1cc2c(cc1OC)-c1c3c(cc4cccc(c14)N(C)C2=O)OCO3 |
| InChI | InChI=1S/C21H17NO5/c1-22-14-6-4-5-11-7-17-20(27-10-26-17)19(18(11)14)12-8-15(24-2)16(25-3)9-13(12)21(22)23/h4-9H,10H2,1-3H3 |
| InChIKey | BTOPVUOSOJCDTR-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |