C23H13F3N2O — CID 12015038
phenyl-[6-(trifluoromethyl)indolo[1,2-c]quinazolin-12-yl]methanone (PubChem CID 12015038) has the molecular formula C23H13F3N2O and a molecular weight of 390.36 g/mol. Its IUPAC name is phenyl-[6-(trifluoromethyl)indolo[1,2-c]quinazolin-12-yl]methanone.
| Compound Name | phenyl-[6-(trifluoromethyl)indolo[1,2-c]quinazolin-12-yl]methanone |
|---|---|
| PubChem CID | 12015038 |
| Molecular Formula | C23H13F3N2O |
| Molecular Weight | 390.36 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | phenyl-[6-(trifluoromethyl)indolo[1,2-c]quinazolin-12-yl]methanone |
| SMILES | O=C(c1ccccc1)c1c2ccccc2n2c(C(F)(F)F)nc3ccccc3c12 |
| InChI | InChI=1S/C23H13F3N2O/c24-23(25,26)22-27-17-12-6-4-10-15(17)20-19(21(29)14-8-2-1-3-9-14)16-11-5-7-13-18(16)28(20)22/h1-13H |
| InChIKey | GUAJQKXWIJJEBV-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.36 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |