C25H15F3N2O — CID 12015039
(E)-3-phenyl-1-[6-(trifluoromethyl)indolo[1,2-c]quinazolin-12-yl]prop-2-en-1-one (PubChem CID 12015039) has the molecular formula C25H15F3N2O and a molecular weight of 416.40 g/mol. Its IUPAC name is (E)-3-phenyl-1-[6-(trifluoromethyl)indolo[1,2-c]quinazolin-12-yl]prop-2-en-1-one.
| Compound Name | (E)-3-phenyl-1-[6-(trifluoromethyl)indolo[1,2-c]quinazolin-12-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 12015039 |
| Molecular Formula | C25H15F3N2O |
| Molecular Weight | 416.40 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | (E)-3-phenyl-1-[6-(trifluoromethyl)indolo[1,2-c]quinazolin-12-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccccc1)c1c2ccccc2n2c(C(F)(F)F)nc3ccccc3c12 |
| InChI | InChI=1S/C25H15F3N2O/c26-25(27,28)24-29-19-12-6-4-10-17(19)23-22(18-11-5-7-13-20(18)30(23)24)21(31)15-14-16-8-2-1-3-9-16/h1-15H/b15-14+ |
| InChIKey | KRAKEECBTZZHCB-CCEZHUSRSA-N |
| XLogP | 6.56 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.40 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|