C23H26N4 — CID 12016074
6-[4-[2-(4-phenylpiperazin-1-yl)ethyl]phenyl]pyridin-2-amine (PubChem CID 12016074) has the molecular formula C23H26N4 and a molecular weight of 358.49 g/mol. Its IUPAC name is 6-[4-[2-(4-phenylpiperazin-1-yl)ethyl]phenyl]pyridin-2-amine.
| Compound Name | 6-[4-[2-(4-phenylpiperazin-1-yl)ethyl]phenyl]pyridin-2-amine |
|---|---|
| PubChem CID | 12016074 |
| Molecular Formula | C23H26N4 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.22 |
| IUPAC Name | 6-[4-[2-(4-phenylpiperazin-1-yl)ethyl]phenyl]pyridin-2-amine |
| SMILES | Nc1cccc(-c2ccc(CCN3CCN(c4ccccc4)CC3)cc2)n1 |
| InChI | InChI=1S/C23H26N4/c24-23-8-4-7-22(25-23)20-11-9-19(10-12-20)13-14-26-15-17-27(18-16-26)21-5-2-1-3-6-21/h1-12H,13-18H2,(H2,24,25) |
| InChIKey | SIDXGAUJNQFMSD-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |