C20H26N4 — CID 18414542
8-[2-[4-(6-amino-2-pyridinyl)phenyl]ethyl]-8-azabicyclo[3.2.1]octan-3-amine (PubChem CID 18414542) has the molecular formula C20H26N4 and a molecular weight of 322.46 g/mol. Its IUPAC name is 8-[2-[4-(6-amino-2-pyridinyl)phenyl]ethyl]-8-azabicyclo[3.2.1]octan-3-amine.
| Compound Name | 8-[2-[4-(6-amino-2-pyridinyl)phenyl]ethyl]-8-azabicyclo[3.2.1]octan-3-amine |
|---|---|
| PubChem CID | 18414542 |
| Molecular Formula | C20H26N4 |
| Molecular Weight | 322.46 g/mol |
| Exact Mass | 322.22 |
| IUPAC Name | 8-[2-[4-(6-amino-2-pyridinyl)phenyl]ethyl]-8-azabicyclo[3.2.1]octan-3-amine |
| SMILES | Nc1cccc(-c2ccc(CCN3C4CCC3CC(N)C4)cc2)n1 |
| InChI | InChI=1S/C20H26N4/c21-16-12-17-8-9-18(13-16)24(17)11-10-14-4-6-15(7-5-14)19-2-1-3-20(22)23-19/h1-7,16-18H,8-13,21H2,(H2,22,23) |
| InChIKey | TWJHFSYMBVCUGP-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.46 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |