C25H29N5O — CID 57279783
1-[1-[2-[4-(6-amino-2-pyridinyl)phenyl]ethyl]pyrrolidin-3-yl]-1-benzylurea (PubChem CID 57279783) has the molecular formula C25H29N5O and a molecular weight of 415.54 g/mol. Its IUPAC name is 1-[1-[2-[4-(6-amino-2-pyridinyl)phenyl]ethyl]pyrrolidin-3-yl]-1-benzylurea.
| Compound Name | 1-[1-[2-[4-(6-amino-2-pyridinyl)phenyl]ethyl]pyrrolidin-3-yl]-1-benzylurea |
|---|---|
| PubChem CID | 57279783 |
| Molecular Formula | C25H29N5O |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.24 |
| IUPAC Name | 1-[1-[2-[4-(6-amino-2-pyridinyl)phenyl]ethyl]pyrrolidin-3-yl]-1-benzylurea |
| SMILES | NC(=O)N(Cc1ccccc1)C1CCN(CCc2ccc(-c3cccc(N)n3)cc2)C1 |
| InChI | InChI=1S/C25H29N5O/c26-24-8-4-7-23(28-24)21-11-9-19(10-12-21)13-15-29-16-14-22(18-29)30(25(27)31)17-20-5-2-1-3-6-20/h1-12,22H,13-18H2,(H2,26,28)(H2,27,31) |
| InChIKey | GRIRNDDICUJUCY-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |