C51H56Cl2N8O — CID 151062106
2,4-bis[4-[2-[4-(6-amino-2-pyridinyl)phenyl]ethyl]piperazin-1-yl]-1,5-bis(4-chlorophenyl)pentan-3-one (PubChem CID 151062106) has the molecular formula C51H56Cl2N8O and a molecular weight of 867.97 g/mol. Its IUPAC name is 2,4-bis[4-[2-[4-(6-amino-2-pyridinyl)phenyl]ethyl]piperazin-1-yl]-1,5-bis(4-chlorophenyl)pentan-3-one.
| Compound Name | 2,4-bis[4-[2-[4-(6-amino-2-pyridinyl)phenyl]ethyl]piperazin-1-yl]-1,5-bis(4-chlorophenyl)pentan-3-one |
|---|---|
| PubChem CID | 151062106 |
| Molecular Formula | C51H56Cl2N8O |
| Molecular Weight | 867.97 g/mol |
| Exact Mass | 866.40 |
| IUPAC Name | 2,4-bis[4-[2-[4-(6-amino-2-pyridinyl)phenyl]ethyl]piperazin-1-yl]-1,5-bis(4-chlorophenyl)pentan-3-one |
| SMILES | Nc1cccc(-c2ccc(CCN3CCN(C(Cc4ccc(Cl)cc4)C(=O)C(Cc4ccc(Cl)cc4)N4CCN(CCc5ccc(-c6cccc(N)n6)cc5)CC4)CC3)cc2)n1 |
| InChI | InChI=1S/C51H56Cl2N8O/c52-43-19-11-39(12-20-43)35-47(60-31-27-58(28-32-60)25-23-37-7-15-41(16-8-37)45-3-1-5-49(54)56-45)51(62)48(36-40-13-21-44(53)22-14-40)61-33-29-59(30-34-61)26-24-38-9-17-42(18-10-38)46-4-2-6-50(55)57-46/h1-22,47-48H,23-36H2,(H2,54,56)(H2,55,57) |
| InChIKey | MGJSEKIRPCILLD-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 107.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 867.97 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |