C27H32N4O — CID 174462905
2-[4-[2-[4-(6-amino-2-pyridinyl)-2-methylphenyl]ethyl]piperazin-1-yl]-3-phenylpropanal (PubChem CID 174462905) has the molecular formula C27H32N4O and a molecular weight of 428.58 g/mol. Its IUPAC name is 2-[4-[2-[4-(6-amino-2-pyridinyl)-2-methylphenyl]ethyl]piperazin-1-yl]-3-phenylpropanal.
| Compound Name | 2-[4-[2-[4-(6-amino-2-pyridinyl)-2-methylphenyl]ethyl]piperazin-1-yl]-3-phenylpropanal |
|---|---|
| PubChem CID | 174462905 |
| Molecular Formula | C27H32N4O |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.26 |
| IUPAC Name | 2-[4-[2-[4-(6-amino-2-pyridinyl)-2-methylphenyl]ethyl]piperazin-1-yl]-3-phenylpropanal |
| SMILES | Cc1cc(-c2cccc(N)n2)ccc1CCN1CCN(C(C=O)Cc2ccccc2)CC1 |
| InChI | InChI=1S/C27H32N4O/c1-21-18-24(26-8-5-9-27(28)29-26)11-10-23(21)12-13-30-14-16-31(17-15-30)25(20-32)19-22-6-3-2-4-7-22/h2-11,18,20,25H,12-17,19H2,1H3,(H2,28,29) |
| InChIKey | BQSJMNQWWFOWIG-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|