C26H32N4 — CID 18414414
6-[4-[2-[4-(1-phenylpropan-2-yl)piperazin-1-yl]ethyl]phenyl]pyridin-2-amine (PubChem CID 18414414) has the molecular formula C26H32N4 and a molecular weight of 400.57 g/mol. Its IUPAC name is 6-[4-[2-[4-(1-phenylpropan-2-yl)piperazin-1-yl]ethyl]phenyl]pyridin-2-amine.
| Compound Name | 6-[4-[2-[4-(1-phenylpropan-2-yl)piperazin-1-yl]ethyl]phenyl]pyridin-2-amine |
|---|---|
| PubChem CID | 18414414 |
| Molecular Formula | C26H32N4 |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | 6-[4-[2-[4-(1-phenylpropan-2-yl)piperazin-1-yl]ethyl]phenyl]pyridin-2-amine |
| SMILES | CC(Cc1ccccc1)N1CCN(CCc2ccc(-c3cccc(N)n3)cc2)CC1 |
| InChI | InChI=1S/C26H32N4/c1-21(20-23-6-3-2-4-7-23)30-18-16-29(17-19-30)15-14-22-10-12-24(13-11-22)25-8-5-9-26(27)28-25/h2-13,21H,14-20H2,1H3,(H2,27,28) |
| InChIKey | PAPMUDRLRHHZPU-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |