C24H15Cl2N3O2S — CID 12019965
(5Z)-5-[[4-(1-benzyl-5,6-dichlorobenzimidazol-2-yl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 12019965) has the molecular formula C24H15Cl2N3O2S and a molecular weight of 480.38 g/mol. Its IUPAC name is (5Z)-5-[[4-(1-benzyl-5,6-dichlorobenzimidazol-2-yl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[4-(1-benzyl-5,6-dichlorobenzimidazol-2-yl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 12019965 |
| Molecular Formula | C24H15Cl2N3O2S |
| Molecular Weight | 480.38 g/mol |
| Exact Mass | 479.03 |
| IUPAC Name | (5Z)-5-[[4-(1-benzyl-5,6-dichlorobenzimidazol-2-yl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C/c2ccc(-c3nc4cc(Cl)c(Cl)cc4n3Cc3ccccc3)cc2)S1 |
| InChI | InChI=1S/C24H15Cl2N3O2S/c25-17-11-19-20(12-18(17)26)29(13-15-4-2-1-3-5-15)22(27-19)16-8-6-14(7-9-16)10-21-23(30)28-24(31)32-21/h1-12H,13H2,(H,28,30,31)/b21-10- |
| InChIKey | GUKXSCJQRGKGII-FBHDLOMBSA-N |
| XLogP | 6.38 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.38 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|