C26H19Cl2N3O2S — CID 73176419
5-[[4-[1-[(3,4-dichlorophenyl)methyl]-5,6-dimethylbenzimidazol-2-yl]phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 73176419) has the molecular formula C26H19Cl2N3O2S and a molecular weight of 508.43 g/mol. Its IUPAC name is 5-[[4-[1-[(3,4-dichlorophenyl)methyl]-5,6-dimethylbenzimidazol-2-yl]phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[1-[(3,4-dichlorophenyl)methyl]-5,6-dimethylbenzimidazol-2-yl]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 73176419 |
| Molecular Formula | C26H19Cl2N3O2S |
| Molecular Weight | 508.43 g/mol |
| Exact Mass | 507.06 |
| IUPAC Name | 5-[[4-[1-[(3,4-dichlorophenyl)methyl]-5,6-dimethylbenzimidazol-2-yl]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1cc2nc(-c3ccc(C=C4SC(=O)NC4=O)cc3)n(Cc3ccc(Cl)c(Cl)c3)c2cc1C |
| InChI | InChI=1S/C26H19Cl2N3O2S/c1-14-9-21-22(10-15(14)2)31(13-17-5-8-19(27)20(28)11-17)24(29-21)18-6-3-16(4-7-18)12-23-25(32)30-26(33)34-23/h3-12H,13H2,1-2H3,(H,30,32,33) |
| InChIKey | MISRFAYBVVTJKV-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.43 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|