About N-(5H-indeno[1,2-b]pyridin-4-yl)acetamide
N-(5H-indeno[1,2-b]pyridin-4-yl)acetamide (PubChem CID 12025246) has the molecular formula C14H12N2O
and a molecular weight of 224.26 g/mol. Its IUPAC name is N-(5H-indeno[1,2-b]pyridin-4-yl)acetamide.
Molecular Properties
| Compound Name | N-(5H-indeno[1,2-b]pyridin-4-yl)acetamide |
| PubChem CID | 12025246 |
| Molecular Formula | C14H12N2O |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | N-(5H-indeno[1,2-b]pyridin-4-yl)acetamide |
| SMILES | CC(=O)Nc1ccnc2c1Cc1ccccc1-2 |
| InChI | InChI=1S/C14H12N2O/c1-9(17)16-13-6-7-15-14-11-5-3-2-4-10(11)8-12(13)14/h2-7H,8H2,1H3,(H,15,16,17) |
| InChIKey | KBHOXZRTOBFUBW-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(5H-indeno[1,2-b]pyridin-4-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5H-indeno[1,2-b]pyridin-4-yl)acetamide?
The IUPAC name of N-(5H-indeno[1,2-b]pyridin-4-yl)acetamide (CID 12025246) is N-(5H-indeno[1,2-b]pyridin-4-yl)acetamide.
What is the SMILES notation for N-(5H-indeno[1,2-b]pyridin-4-yl)acetamide?
The canonical SMILES for N-(5H-indeno[1,2-b]pyridin-4-yl)acetamide is CC(=O)Nc1ccnc2c1Cc1ccccc1-2.
What is the InChIKey of N-(5H-indeno[1,2-b]pyridin-4-yl)acetamide?
The InChIKey is KBHOXZRTOBFUBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2O/c1-9(17)16-13-6-7-15-14-11-5-3-2-4-10(11)8-12(13)14/h2-7H,8H2,1H3,(H,15,16,17).
What are the key properties of N-(5H-indeno[1,2-b]pyridin-4-yl)acetamide?
N-(5H-indeno[1,2-b]pyridin-4-yl)acetamide has a molecular weight of 224.26 g/mol, XLogP of 2.61, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5H-indeno[1,2-b]pyridin-4-yl)acetamide is sourced from PubChem (CID 12025246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).