C14H12N2O — CID 12025246
N-(5H-indeno[1,2-b]pyridin-4-yl)acetamide (PubChem CID 12025246) has the molecular formula C14H12N2O and a molecular weight of 224.26 g/mol. Its IUPAC name is N-(5H-indeno[1,2-b]pyridin-4-yl)acetamide.
| Compound Name | N-(5H-indeno[1,2-b]pyridin-4-yl)acetamide |
|---|---|
| PubChem CID | 12025246 |
| Molecular Formula | C14H12N2O |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | N-(5H-indeno[1,2-b]pyridin-4-yl)acetamide |
| SMILES | CC(=O)Nc1ccnc2c1Cc1ccccc1-2 |
| InChI | InChI=1S/C14H12N2O/c1-9(17)16-13-6-7-15-14-11-5-3-2-4-10(11)8-12(13)14/h2-7H,8H2,1H3,(H,15,16,17) |
| InChIKey | KBHOXZRTOBFUBW-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |