C16H22O2S — CID 12027293
[(2R,4R)-4-phenylsulfanyl-1-oxaspiro[4.5]decan-2-yl]methanol (PubChem CID 12027293) has the molecular formula C16H22O2S and a molecular weight of 278.42 g/mol. Its IUPAC name is [(2R,4R)-4-phenylsulfanyl-1-oxaspiro[4.5]decan-2-yl]methanol.
| Compound Name | [(2R,4R)-4-phenylsulfanyl-1-oxaspiro[4.5]decan-2-yl]methanol |
|---|---|
| PubChem CID | 12027293 |
| Molecular Formula | C16H22O2S |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | [(2R,4R)-4-phenylsulfanyl-1-oxaspiro[4.5]decan-2-yl]methanol |
| SMILES | OC[C@H]1C[C@@H](Sc2ccccc2)C2(CCCCC2)O1 |
| InChI | InChI=1S/C16H22O2S/c17-12-13-11-15(19-14-7-3-1-4-8-14)16(18-13)9-5-2-6-10-16/h1,3-4,7-8,13,15,17H,2,5-6,9-12H2/t13-,15-/m1/s1 |
| InChIKey | QJPMTQNGYBQJPK-UKRRQHHQSA-N |
| XLogP | 3.63 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |