C18H22N4O4S — CID 12032096
N-methyl-N'-(4-methylphenyl)-N-[2-[(3-nitrophenyl)sulfonylamino]ethyl]ethanimidamide (PubChem CID 12032096) has the molecular formula C18H22N4O4S and a molecular weight of 390.47 g/mol. Its IUPAC name is N-methyl-N'-(4-methylphenyl)-N-[2-[(3-nitrophenyl)sulfonylamino]ethyl]ethanimidamide.
| Compound Name | N-methyl-N'-(4-methylphenyl)-N-[2-[(3-nitrophenyl)sulfonylamino]ethyl]ethanimidamide |
|---|---|
| PubChem CID | 12032096 |
| Molecular Formula | C18H22N4O4S |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | N-methyl-N'-(4-methylphenyl)-N-[2-[(3-nitrophenyl)sulfonylamino]ethyl]ethanimidamide |
| SMILES | C/C(=N\c1ccc(C)cc1)N(C)CCNS(=O)(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H22N4O4S/c1-14-7-9-16(10-8-14)20-15(2)21(3)12-11-19-27(25,26)18-6-4-5-17(13-18)22(23)24/h4-10,13,19H,11-12H2,1-3H3/b20-15+ |
| InChIKey | FJNCWLWKBMKVNA-HMMYKYKNSA-N |
| XLogP | 2.86 |
| TPSA | 104.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|