C17H19ClFN3O2S — CID 90683507
N-[2-[(4-chlorophenyl)sulfonylamino]ethyl]-N'-(4-fluorophenyl)-N-methylethanimidamide (PubChem CID 90683507) has the molecular formula C17H19ClFN3O2S and a molecular weight of 383.88 g/mol. Its IUPAC name is N-[2-[(4-chlorophenyl)sulfonylamino]ethyl]-N'-(4-fluorophenyl)-N-methylethanimidamide.
| Compound Name | N-[2-[(4-chlorophenyl)sulfonylamino]ethyl]-N'-(4-fluorophenyl)-N-methylethanimidamide |
|---|---|
| PubChem CID | 90683507 |
| Molecular Formula | C17H19ClFN3O2S |
| Molecular Weight | 383.88 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | N-[2-[(4-chlorophenyl)sulfonylamino]ethyl]-N'-(4-fluorophenyl)-N-methylethanimidamide |
| SMILES | C/C(=N\c1ccc(F)cc1)N(C)CCNS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H19ClFN3O2S/c1-13(21-16-7-5-15(19)6-8-16)22(2)12-11-20-25(23,24)17-9-3-14(18)4-10-17/h3-10,20H,11-12H2,1-2H3/b21-13+ |
| InChIKey | OMAGXKHTVIIRLA-FYJGNVAPSA-N |
| XLogP | 3.44 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.88 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|