C7H11IO2 — CID 12039541
(3R,4R)-3-(1-iodoethenyl)-4-methoxyoxolane (PubChem CID 12039541) has the molecular formula C7H11IO2 and a molecular weight of 254.07 g/mol. Its IUPAC name is (3R,4R)-3-(1-iodoethenyl)-4-methoxyoxolane.
| Compound Name | (3R,4R)-3-(1-iodoethenyl)-4-methoxyoxolane |
|---|---|
| PubChem CID | 12039541 |
| Molecular Formula | C7H11IO2 |
| Molecular Weight | 254.07 g/mol |
| Exact Mass | 253.98 |
| IUPAC Name | (3R,4R)-3-(1-iodoethenyl)-4-methoxyoxolane |
| SMILES | C=C(I)[C@@H]1COC[C@@H]1OC |
| InChI | InChI=1S/C7H11IO2/c1-5(8)6-3-10-4-7(6)9-2/h6-7H,1,3-4H2,2H3/t6-,7-/m0/s1 |
| InChIKey | JZBIVTZKSMNVNZ-BQBZGAKWSA-N |
| XLogP | 1.60 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.07 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|