C26H35IO2S — CID 12043784
(3S,4S)-4-(8-iodooctyl)-7-methoxy-3-(4-methoxyphenyl)-3-methyl-2,4-dihydrothiochromene (PubChem CID 12043784) has the molecular formula C26H35IO2S and a molecular weight of 538.54 g/mol. Its IUPAC name is (3S,4S)-4-(8-iodooctyl)-7-methoxy-3-(4-methoxyphenyl)-3-methyl-2,4-dihydrothiochromene.
| Compound Name | (3S,4S)-4-(8-iodooctyl)-7-methoxy-3-(4-methoxyphenyl)-3-methyl-2,4-dihydrothiochromene |
|---|---|
| PubChem CID | 12043784 |
| Molecular Formula | C26H35IO2S |
| Molecular Weight | 538.54 g/mol |
| Exact Mass | 538.14 |
| IUPAC Name | (3S,4S)-4-(8-iodooctyl)-7-methoxy-3-(4-methoxyphenyl)-3-methyl-2,4-dihydrothiochromene |
| SMILES | COc1ccc([C@@]2(C)CSc3cc(OC)ccc3[C@H]2CCCCCCCCI)cc1 |
| InChI | InChI=1S/C26H35IO2S/c1-26(20-11-13-21(28-2)14-12-20)19-30-25-18-22(29-3)15-16-23(25)24(26)10-8-6-4-5-7-9-17-27/h11-16,18,24H,4-10,17,19H2,1-3H3/t24-,26-/m1/s1 |
| InChIKey | LKMOALOWEWRHTQ-AOYPEHQESA-N |
| XLogP | 8.02 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.54 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|