C29H50O5SSi — CID 12050779
methyl 7-[(1R,2R,3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2-(3-hydroxy-4-phenylsulfanylbutyl)cyclopentyl]heptanoate (PubChem CID 12050779) has the molecular formula C29H50O5SSi and a molecular weight of 538.87 g/mol. Its IUPAC name is methyl 7-[(1R,2R,3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2-(3-hydroxy-4-phenylsulfanylbutyl)cyclopentyl]heptanoate.
| Compound Name | methyl 7-[(1R,2R,3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2-(3-hydroxy-4-phenylsulfanylbutyl)cyclopentyl]heptanoate |
|---|---|
| PubChem CID | 12050779 |
| Molecular Formula | C29H50O5SSi |
| Molecular Weight | 538.87 g/mol |
| Exact Mass | 538.31 |
| IUPAC Name | methyl 7-[(1R,2R,3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2-(3-hydroxy-4-phenylsulfanylbutyl)cyclopentyl]heptanoate |
| SMILES | COC(=O)CCCCCC[C@@H]1[C@@H](CCC(O)CSc2ccccc2)[C@H](O[Si](C)(C)C(C)(C)C)C[C@@H]1O |
| InChI | InChI=1S/C29H50O5SSi/c1-29(2,3)36(5,6)34-27-20-26(31)24(16-12-7-8-13-17-28(32)33-4)25(27)19-18-22(30)21-35-23-14-10-9-11-15-23/h9-11,14-15,22,24-27,30-31H,7-8,12-13,16-21H2,1-6H3/t22?,24-,25-,26+,27-/m1/s1 |
| InChIKey | PVOJDTDZOPQHHV-DQYPTEBESA-N |
| XLogP | 6.82 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.87 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|