C27H40O7S — CID 12050781
methyl 7-[(1R,2R,3R,5S)-5-acetyloxy-2-(3-acetyloxy-4-phenylsulfanylbutyl)-3-hydroxycyclopentyl]heptanoate (PubChem CID 12050781) has the molecular formula C27H40O7S and a molecular weight of 508.68 g/mol. Its IUPAC name is methyl 7-[(1R,2R,3R,5S)-5-acetyloxy-2-(3-acetyloxy-4-phenylsulfanylbutyl)-3-hydroxycyclopentyl]heptanoate.
| Compound Name | methyl 7-[(1R,2R,3R,5S)-5-acetyloxy-2-(3-acetyloxy-4-phenylsulfanylbutyl)-3-hydroxycyclopentyl]heptanoate |
|---|---|
| PubChem CID | 12050781 |
| Molecular Formula | C27H40O7S |
| Molecular Weight | 508.68 g/mol |
| Exact Mass | 508.25 |
| IUPAC Name | methyl 7-[(1R,2R,3R,5S)-5-acetyloxy-2-(3-acetyloxy-4-phenylsulfanylbutyl)-3-hydroxycyclopentyl]heptanoate |
| SMILES | COC(=O)CCCCCC[C@@H]1[C@@H](CCC(CSc2ccccc2)OC(C)=O)[C@H](O)C[C@@H]1OC(C)=O |
| InChI | InChI=1S/C27H40O7S/c1-19(28)33-21(18-35-22-11-7-6-8-12-22)15-16-23-24(26(17-25(23)30)34-20(2)29)13-9-4-5-10-14-27(31)32-3/h6-8,11-12,21,23-26,30H,4-5,9-10,13-18H2,1-3H3/t21?,23-,24-,25-,26+/m1/s1 |
| InChIKey | IHAGOAXYNWEDBE-KZIWEJABSA-N |
| XLogP | 4.93 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.68 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|