C17H26N2O4 — CID 120532497
3-[(2-butan-2-yloxypyridine-4-carbonyl)amino]-3-ethylpentanoic acid (PubChem CID 120532497) has the molecular formula C17H26N2O4 and a molecular weight of 322.41 g/mol. Its IUPAC name is 3-[(2-butan-2-yloxypyridine-4-carbonyl)amino]-3-ethylpentanoic acid.
| Compound Name | 3-[(2-butan-2-yloxypyridine-4-carbonyl)amino]-3-ethylpentanoic acid |
|---|---|
| PubChem CID | 120532497 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | 3-[(2-butan-2-yloxypyridine-4-carbonyl)amino]-3-ethylpentanoic acid |
| SMILES | CCC(C)Oc1cc(C(=O)NC(CC)(CC)CC(=O)O)ccn1 |
| InChI | InChI=1S/C17H26N2O4/c1-5-12(4)23-14-10-13(8-9-18-14)16(22)19-17(6-2,7-3)11-15(20)21/h8-10,12H,5-7,11H2,1-4H3,(H,19,22)(H,20,21) |
| InChIKey | NIECOTYHTKBJMH-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |