C14H20N2O5S2 — CID 120545878
2-methyl-2-[[2-(thiophen-2-ylsulfonylamino)acetyl]amino]cyclohexane-1-carboxylic acid (PubChem CID 120545878) has the molecular formula C14H20N2O5S2 and a molecular weight of 360.46 g/mol. Its IUPAC name is 2-methyl-2-[[2-(thiophen-2-ylsulfonylamino)acetyl]amino]cyclohexane-1-carboxylic acid.
| Compound Name | 2-methyl-2-[[2-(thiophen-2-ylsulfonylamino)acetyl]amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 120545878 |
| Molecular Formula | C14H20N2O5S2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 2-methyl-2-[[2-(thiophen-2-ylsulfonylamino)acetyl]amino]cyclohexane-1-carboxylic acid |
| SMILES | CC1(NC(=O)CNS(=O)(=O)c2cccs2)CCCCC1C(=O)O |
| InChI | InChI=1S/C14H20N2O5S2/c1-14(7-3-2-5-10(14)13(18)19)16-11(17)9-15-23(20,21)12-6-4-8-22-12/h4,6,8,10,15H,2-3,5,7,9H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | FNGUFEWOHAXLGT-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |