C15H23N3O4S2 — CID 51123545
N-ethyl-1-[[2-(thiophen-2-ylsulfonylamino)acetyl]amino]cyclohexane-1-carboxamide (PubChem CID 51123545) has the molecular formula C15H23N3O4S2 and a molecular weight of 373.50 g/mol. Its IUPAC name is N-ethyl-1-[[2-(thiophen-2-ylsulfonylamino)acetyl]amino]cyclohexane-1-carboxamide.
| Compound Name | N-ethyl-1-[[2-(thiophen-2-ylsulfonylamino)acetyl]amino]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 51123545 |
| Molecular Formula | C15H23N3O4S2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | N-ethyl-1-[[2-(thiophen-2-ylsulfonylamino)acetyl]amino]cyclohexane-1-carboxamide |
| SMILES | CCNC(=O)C1(NC(=O)CNS(=O)(=O)c2cccs2)CCCCC1 |
| InChI | InChI=1S/C15H23N3O4S2/c1-2-16-14(20)15(8-4-3-5-9-15)18-12(19)11-17-24(21,22)13-7-6-10-23-13/h6-7,10,17H,2-5,8-9,11H2,1H3,(H,16,20)(H,18,19) |
| InChIKey | OYOZIGWMLNZUGO-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |