C17H22N2O6S — CID 120547893
2-(oxan-3-yl)-2-[[3-(prop-2-enylsulfamoyl)benzoyl]amino]acetic acid (PubChem CID 120547893) has the molecular formula C17H22N2O6S and a molecular weight of 382.44 g/mol. Its IUPAC name is 2-(oxan-3-yl)-2-[[3-(prop-2-enylsulfamoyl)benzoyl]amino]acetic acid.
| Compound Name | 2-(oxan-3-yl)-2-[[3-(prop-2-enylsulfamoyl)benzoyl]amino]acetic acid |
|---|---|
| PubChem CID | 120547893 |
| Molecular Formula | C17H22N2O6S |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | 2-(oxan-3-yl)-2-[[3-(prop-2-enylsulfamoyl)benzoyl]amino]acetic acid |
| SMILES | C=CCNS(=O)(=O)c1cccc(C(=O)NC(C(=O)O)C2CCCOC2)c1 |
| InChI | InChI=1S/C17H22N2O6S/c1-2-8-18-26(23,24)14-7-3-5-12(10-14)16(20)19-15(17(21)22)13-6-4-9-25-11-13/h2-3,5,7,10,13,15,18H,1,4,6,8-9,11H2,(H,19,20)(H,21,22) |
| InChIKey | VPJMELDOZHYGSE-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|