C18H28Cl2N2O3 — CID 120572679
(4-butoxy-3-chloro-5-methoxyphenyl)-(2,3-dimethylpiperazin-1-yl)methanone;hydrochloride (PubChem CID 120572679) has the molecular formula C18H28Cl2N2O3 and a molecular weight of 391.34 g/mol. Its IUPAC name is (4-butoxy-3-chloro-5-methoxyphenyl)-(2,3-dimethylpiperazin-1-yl)methanone;hydrochloride.
| Compound Name | (4-butoxy-3-chloro-5-methoxyphenyl)-(2,3-dimethylpiperazin-1-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 120572679 |
| Molecular Formula | C18H28Cl2N2O3 |
| Molecular Weight | 391.34 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | (4-butoxy-3-chloro-5-methoxyphenyl)-(2,3-dimethylpiperazin-1-yl)methanone;hydrochloride |
| SMILES | CCCCOc1c(Cl)cc(C(=O)N2CCNC(C)C2C)cc1OC.Cl |
| InChI | InChI=1S/C18H27ClN2O3.ClH/c1-5-6-9-24-17-15(19)10-14(11-16(17)23-4)18(22)21-8-7-20-12(2)13(21)3;/h10-13,20H,5-9H2,1-4H3;1H |
| InChIKey | DHFAKXGELKFQCS-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.34 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|