C17H20Cl2F3N3OS — CID 120605616
N-[3-(aminomethyl)-5-(trifluoromethyl)phenyl]-3-(pyridin-2-ylmethylsulfanyl)propanamide;dihydrochloride (PubChem CID 120605616) has the molecular formula C17H20Cl2F3N3OS and a molecular weight of 442.33 g/mol. Its IUPAC name is N-[3-(aminomethyl)-5-(trifluoromethyl)phenyl]-3-(pyridin-2-ylmethylsulfanyl)propanamide;dihydrochloride.
| Compound Name | N-[3-(aminomethyl)-5-(trifluoromethyl)phenyl]-3-(pyridin-2-ylmethylsulfanyl)propanamide;dihydrochloride |
|---|---|
| PubChem CID | 120605616 |
| Molecular Formula | C17H20Cl2F3N3OS |
| Molecular Weight | 442.33 g/mol |
| Exact Mass | 441.07 |
| IUPAC Name | N-[3-(aminomethyl)-5-(trifluoromethyl)phenyl]-3-(pyridin-2-ylmethylsulfanyl)propanamide;dihydrochloride |
| SMILES | Cl.Cl.NCc1cc(NC(=O)CCSCc2ccccn2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H18F3N3OS.2ClH/c18-17(19,20)13-7-12(10-21)8-15(9-13)23-16(24)4-6-25-11-14-3-1-2-5-22-14;;/h1-3,5,7-9H,4,6,10-11,21H2,(H,23,24);2*1H |
| InChIKey | SOARQUBKHLOVOJ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.33 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|