C30H29N2P — CID 12061340
diphenyl-[2-[(4S)-1-phenyl-4-propan-2-yl-4,5-dihydroimidazol-2-yl]phenyl]phosphane (PubChem CID 12061340) has the molecular formula C30H29N2P and a molecular weight of 448.55 g/mol. Its IUPAC name is diphenyl-[2-[(4S)-1-phenyl-4-propan-2-yl-4,5-dihydroimidazol-2-yl]phenyl]phosphane.
| Compound Name | diphenyl-[2-[(4S)-1-phenyl-4-propan-2-yl-4,5-dihydroimidazol-2-yl]phenyl]phosphane |
|---|---|
| PubChem CID | 12061340 |
| Molecular Formula | C30H29N2P |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | diphenyl-[2-[(4S)-1-phenyl-4-propan-2-yl-4,5-dihydroimidazol-2-yl]phenyl]phosphane |
| SMILES | CC(C)[C@H]1CN(c2ccccc2)C(c2ccccc2P(c2ccccc2)c2ccccc2)=N1 |
| InChI | InChI=1S/C30H29N2P/c1-23(2)28-22-32(24-14-6-3-7-15-24)30(31-28)27-20-12-13-21-29(27)33(25-16-8-4-9-17-25)26-18-10-5-11-19-26/h3-21,23,28H,22H2,1-2H3/t28-/m1/s1 |
| InChIKey | AHHHPCYXAVMQMO-MUUNZHRXSA-N |
| XLogP | 5.74 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|