C18H29NO3Si — CID 12065757
(4S,5R)-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-(pyridin-2-ylmethyl)oxolan-2-one (PubChem CID 12065757) has the molecular formula C18H29NO3Si and a molecular weight of 335.52 g/mol. Its IUPAC name is (4S,5R)-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-(pyridin-2-ylmethyl)oxolan-2-one.
| Compound Name | (4S,5R)-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-(pyridin-2-ylmethyl)oxolan-2-one |
|---|---|
| PubChem CID | 12065757 |
| Molecular Formula | C18H29NO3Si |
| Molecular Weight | 335.52 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | (4S,5R)-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-(pyridin-2-ylmethyl)oxolan-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OCC[C@H]1OC(=O)C[C@@H]1Cc1ccccn1 |
| InChI | InChI=1S/C18H29NO3Si/c1-18(2,3)23(4,5)21-11-9-16-14(13-17(20)22-16)12-15-8-6-7-10-19-15/h6-8,10,14,16H,9,11-13H2,1-5H3/t14-,16+/m0/s1 |
| InChIKey | DDQAAMKBJBLRGU-GOEBONIOSA-N |
| XLogP | 3.97 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.52 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|