C13H23IN4OS — CID 120662075
2-methyl-N'-[2-(4-methyl-1,3-thiazol-2-yl)propyl]morpholine-4-carboximidamide;hydroiodide (PubChem CID 120662075) has the molecular formula C13H23IN4OS and a molecular weight of 410.33 g/mol. Its IUPAC name is 2-methyl-N'-[2-(4-methyl-1,3-thiazol-2-yl)propyl]morpholine-4-carboximidamide;hydroiodide.
| Compound Name | 2-methyl-N'-[2-(4-methyl-1,3-thiazol-2-yl)propyl]morpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 120662075 |
| Molecular Formula | C13H23IN4OS |
| Molecular Weight | 410.33 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | 2-methyl-N'-[2-(4-methyl-1,3-thiazol-2-yl)propyl]morpholine-4-carboximidamide;hydroiodide |
| SMILES | Cc1csc(C(C)C/N=C(\N)N2CCOC(C)C2)n1.I |
| InChI | InChI=1S/C13H22N4OS.HI/c1-9(12-16-10(2)8-19-12)6-15-13(14)17-4-5-18-11(3)7-17;/h8-9,11H,4-7H2,1-3H3,(H2,14,15);1H |
| InChIKey | QNAVAQQLTLJDCM-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 63.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.33 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|