C17H20N2O3 — CID 120692866
(E)-2-[(4,6-dimethyl-1H-indole-2-carbonyl)amino]hex-4-enoic acid (PubChem CID 120692866) has the molecular formula C17H20N2O3 and a molecular weight of 300.36 g/mol. Its IUPAC name is (E)-2-[(4,6-dimethyl-1H-indole-2-carbonyl)amino]hex-4-enoic acid.
| Compound Name | (E)-2-[(4,6-dimethyl-1H-indole-2-carbonyl)amino]hex-4-enoic acid |
|---|---|
| PubChem CID | 120692866 |
| Molecular Formula | C17H20N2O3 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | (E)-2-[(4,6-dimethyl-1H-indole-2-carbonyl)amino]hex-4-enoic acid |
| SMILES | C/C=C/CC(NC(=O)c1cc2c(C)cc(C)cc2[nH]1)C(=O)O |
| InChI | InChI=1S/C17H20N2O3/c1-4-5-6-13(17(21)22)19-16(20)15-9-12-11(3)7-10(2)8-14(12)18-15/h4-5,7-9,13,18H,6H2,1-3H3,(H,19,20)(H,21,22)/b5-4+ |
| InChIKey | SANSMAIGQQKKMD-SNAWJCMRSA-N |
| XLogP | 2.93 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|