C15H25FN2O4S — CID 120712250
N-(3-amino-2,2-dimethylpropyl)-5-fluoro-2-(2-methoxyethoxy)-N-methylbenzenesulfonamide (PubChem CID 120712250) has the molecular formula C15H25FN2O4S and a molecular weight of 348.44 g/mol. Its IUPAC name is N-(3-amino-2,2-dimethylpropyl)-5-fluoro-2-(2-methoxyethoxy)-N-methylbenzenesulfonamide.
| Compound Name | N-(3-amino-2,2-dimethylpropyl)-5-fluoro-2-(2-methoxyethoxy)-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 120712250 |
| Molecular Formula | C15H25FN2O4S |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | N-(3-amino-2,2-dimethylpropyl)-5-fluoro-2-(2-methoxyethoxy)-N-methylbenzenesulfonamide |
| SMILES | COCCOc1ccc(F)cc1S(=O)(=O)N(C)CC(C)(C)CN |
| InChI | InChI=1S/C15H25FN2O4S/c1-15(2,10-17)11-18(3)23(19,20)14-9-12(16)5-6-13(14)22-8-7-21-4/h5-6,9H,7-8,10-11,17H2,1-4H3 |
| InChIKey | YMEJUEZLCVEWMY-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|