C9H19ClN2O3S — CID 120721104
2-methoxy-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)ethanesulfonamide;hydrochloride (PubChem CID 120721104) has the molecular formula C9H19ClN2O3S and a molecular weight of 270.78 g/mol. Its IUPAC name is 2-methoxy-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)ethanesulfonamide;hydrochloride.
| Compound Name | 2-methoxy-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)ethanesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120721104 |
| Molecular Formula | C9H19ClN2O3S |
| Molecular Weight | 270.78 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 2-methoxy-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)ethanesulfonamide;hydrochloride |
| SMILES | COCCS(=O)(=O)NCC1=CCNCC1.Cl |
| InChI | InChI=1S/C9H18N2O3S.ClH/c1-14-6-7-15(12,13)11-8-9-2-4-10-5-3-9;/h2,10-11H,3-8H2,1H3;1H |
| InChIKey | FVDLIEWWJIZDPX-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.78 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|