C9H20ClN3O2S — CID 120721128
4-[[[ethyl(methyl)sulfamoyl]amino]methyl]-1,2,3,6-tetrahydropyridine;hydrochloride (PubChem CID 120721128) has the molecular formula C9H20ClN3O2S and a molecular weight of 269.80 g/mol. Its IUPAC name is 4-[[[ethyl(methyl)sulfamoyl]amino]methyl]-1,2,3,6-tetrahydropyridine;hydrochloride.
| Compound Name | 4-[[[ethyl(methyl)sulfamoyl]amino]methyl]-1,2,3,6-tetrahydropyridine;hydrochloride |
|---|---|
| PubChem CID | 120721128 |
| Molecular Formula | C9H20ClN3O2S |
| Molecular Weight | 269.80 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | 4-[[[ethyl(methyl)sulfamoyl]amino]methyl]-1,2,3,6-tetrahydropyridine;hydrochloride |
| SMILES | CCN(C)S(=O)(=O)NCC1=CCNCC1.Cl |
| InChI | InChI=1S/C9H19N3O2S.ClH/c1-3-12(2)15(13,14)11-8-9-4-6-10-7-5-9;/h4,10-11H,3,5-8H2,1-2H3;1H |
| InChIKey | XGQUGMBKHJAUCZ-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.80 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|