C10H21N3O2S — CID 120721245
4-[[[methyl(propyl)sulfamoyl]amino]methyl]-1,2,3,6-tetrahydropyridine (PubChem CID 120721245) has the molecular formula C10H21N3O2S and a molecular weight of 247.36 g/mol. Its IUPAC name is 4-[[[methyl(propyl)sulfamoyl]amino]methyl]-1,2,3,6-tetrahydropyridine.
| Compound Name | 4-[[[methyl(propyl)sulfamoyl]amino]methyl]-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 120721245 |
| Molecular Formula | C10H21N3O2S |
| Molecular Weight | 247.36 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 4-[[[methyl(propyl)sulfamoyl]amino]methyl]-1,2,3,6-tetrahydropyridine |
| SMILES | CCCN(C)S(=O)(=O)NCC1=CCNCC1 |
| InChI | InChI=1S/C10H21N3O2S/c1-3-8-13(2)16(14,15)12-9-10-4-6-11-7-5-10/h4,11-12H,3,5-9H2,1-2H3 |
| InChIKey | LELAIKMODVVLQF-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.36 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|