C13H18ClFN2O2S — CID 120721376
1-(4-fluorophenyl)-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)methanesulfonamide;hydrochloride (PubChem CID 120721376) has the molecular formula C13H18ClFN2O2S and a molecular weight of 320.82 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)methanesulfonamide;hydrochloride.
| Compound Name | 1-(4-fluorophenyl)-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)methanesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120721376 |
| Molecular Formula | C13H18ClFN2O2S |
| Molecular Weight | 320.82 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 1-(4-fluorophenyl)-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)methanesulfonamide;hydrochloride |
| SMILES | Cl.O=S(=O)(Cc1ccc(F)cc1)NCC1=CCNCC1 |
| InChI | InChI=1S/C13H17FN2O2S.ClH/c14-13-3-1-12(2-4-13)10-19(17,18)16-9-11-5-7-15-8-6-11;/h1-5,15-16H,6-10H2;1H |
| InChIKey | GXSDTZPTZBZEIQ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.82 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|