C19H24ClN5O2S — CID 120763905
1-propan-2-yl-5-(2-pyridin-3-ylpiperazin-1-yl)sulfonylindazole;hydrochloride (PubChem CID 120763905) has the molecular formula C19H24ClN5O2S and a molecular weight of 421.95 g/mol. Its IUPAC name is 1-propan-2-yl-5-(2-pyridin-3-ylpiperazin-1-yl)sulfonylindazole;hydrochloride.
| Compound Name | 1-propan-2-yl-5-(2-pyridin-3-ylpiperazin-1-yl)sulfonylindazole;hydrochloride |
|---|---|
| PubChem CID | 120763905 |
| Molecular Formula | C19H24ClN5O2S |
| Molecular Weight | 421.95 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | 1-propan-2-yl-5-(2-pyridin-3-ylpiperazin-1-yl)sulfonylindazole;hydrochloride |
| SMILES | CC(C)n1ncc2cc(S(=O)(=O)N3CCNCC3c3cccnc3)ccc21.Cl |
| InChI | InChI=1S/C19H23N5O2S.ClH/c1-14(2)24-18-6-5-17(10-16(18)12-22-24)27(25,26)23-9-8-21-13-19(23)15-4-3-7-20-11-15;/h3-7,10-12,14,19,21H,8-9,13H2,1-2H3;1H |
| InChIKey | BFVXKEHHASRKMR-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.95 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |