C17H24ClN5O3 — CID 120826430
methyl 5-[[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methyl]furan-3-carboxylate;hydrochloride (PubChem CID 120826430) has the molecular formula C17H24ClN5O3 and a molecular weight of 381.86 g/mol. Its IUPAC name is methyl 5-[[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methyl]furan-3-carboxylate;hydrochloride.
| Compound Name | methyl 5-[[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methyl]furan-3-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 120826430 |
| Molecular Formula | C17H24ClN5O3 |
| Molecular Weight | 381.86 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | methyl 5-[[4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)piperidin-1-yl]methyl]furan-3-carboxylate;hydrochloride |
| SMILES | COC(=O)c1coc(CN2CCC(c3nnc4n3CCNC4)CC2)c1.Cl |
| InChI | InChI=1S/C17H23N5O3.ClH/c1-24-17(23)13-8-14(25-11-13)10-21-5-2-12(3-6-21)16-20-19-15-9-18-4-7-22(15)16;/h8,11-12,18H,2-7,9-10H2,1H3;1H |
| InChIKey | HCKUROADDQYAIA-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 85.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.86 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |