C10H15BrCl2N2S — CID 120834456
1-[(4-bromo-5-chlorothiophen-2-yl)methyl]piperidin-4-amine;hydrochloride (PubChem CID 120834456) has the molecular formula C10H15BrCl2N2S and a molecular weight of 346.12 g/mol. Its IUPAC name is 1-[(4-bromo-5-chlorothiophen-2-yl)methyl]piperidin-4-amine;hydrochloride.
| Compound Name | 1-[(4-bromo-5-chlorothiophen-2-yl)methyl]piperidin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 120834456 |
| Molecular Formula | C10H15BrCl2N2S |
| Molecular Weight | 346.12 g/mol |
| Exact Mass | 343.95 |
| IUPAC Name | 1-[(4-bromo-5-chlorothiophen-2-yl)methyl]piperidin-4-amine;hydrochloride |
| SMILES | Cl.NC1CCN(Cc2cc(Br)c(Cl)s2)CC1 |
| InChI | InChI=1S/C10H14BrClN2S.ClH/c11-9-5-8(15-10(9)12)6-14-3-1-7(13)2-4-14;/h5,7H,1-4,6,13H2;1H |
| InChIKey | QDRSMDXEUQFUJC-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.12 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |