C10H16Cl2N2S — CID 120840158
1-[(4-chlorothiophen-2-yl)methyl]-3-methylpiperazine;hydrochloride (PubChem CID 120840158) has the molecular formula C10H16Cl2N2S and a molecular weight of 267.22 g/mol. Its IUPAC name is 1-[(4-chlorothiophen-2-yl)methyl]-3-methylpiperazine;hydrochloride.
| Compound Name | 1-[(4-chlorothiophen-2-yl)methyl]-3-methylpiperazine;hydrochloride |
|---|---|
| PubChem CID | 120840158 |
| Molecular Formula | C10H16Cl2N2S |
| Molecular Weight | 267.22 g/mol |
| Exact Mass | 266.04 |
| IUPAC Name | 1-[(4-chlorothiophen-2-yl)methyl]-3-methylpiperazine;hydrochloride |
| SMILES | CC1CN(Cc2cc(Cl)cs2)CCN1.Cl |
| InChI | InChI=1S/C10H15ClN2S.ClH/c1-8-5-13(3-2-12-8)6-10-4-9(11)7-14-10;/h4,7-8,12H,2-3,5-6H2,1H3;1H |
| InChIKey | CZGFUSYEUPRBJC-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.22 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |