C12H21ClN2O5S — CID 120874540
methyl 2,5-dimethyl-4-[3-(methylamino)propylsulfamoyl]furan-3-carboxylate;hydrochloride (PubChem CID 120874540) has the molecular formula C12H21ClN2O5S and a molecular weight of 340.83 g/mol. Its IUPAC name is methyl 2,5-dimethyl-4-[3-(methylamino)propylsulfamoyl]furan-3-carboxylate;hydrochloride.
| Compound Name | methyl 2,5-dimethyl-4-[3-(methylamino)propylsulfamoyl]furan-3-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 120874540 |
| Molecular Formula | C12H21ClN2O5S |
| Molecular Weight | 340.83 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | methyl 2,5-dimethyl-4-[3-(methylamino)propylsulfamoyl]furan-3-carboxylate;hydrochloride |
| SMILES | CNCCCNS(=O)(=O)c1c(C)oc(C)c1C(=O)OC.Cl |
| InChI | InChI=1S/C12H20N2O5S.ClH/c1-8-10(12(15)18-4)11(9(2)19-8)20(16,17)14-7-5-6-13-3;/h13-14H,5-7H2,1-4H3;1H |
| InChIKey | OZDUIZYFTFNSMC-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.83 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|